About N,N'-diethyl-N'-(3-methylpyrazin-2-yl)ethane-1,2-diamine
N,N'-diethyl-N'-(3-methylpyrazin-2-yl)ethane-1,2-diamine (PubChem CID 83064976) has the molecular formula C11H20N4
and a molecular weight of 208.31 g/mol. Its IUPAC name is N,N'-diethyl-N'-(3-methylpyrazin-2-yl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N,N'-diethyl-N'-(3-methylpyrazin-2-yl)ethane-1,2-diamine |
| PubChem CID | 83064976 |
| Molecular Formula | C11H20N4 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | N,N'-diethyl-N'-(3-methylpyrazin-2-yl)ethane-1,2-diamine |
| SMILES | CCNCCN(CC)c1nccnc1C |
| InChI | InChI=1S/C11H20N4/c1-4-12-8-9-15(5-2)11-10(3)13-6-7-14-11/h6-7,12H,4-5,8-9H2,1-3H3 |
| InChIKey | QGQVABUZLKVHOO-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N,N'-diethyl-N'-(3-methylpyrazin-2-yl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-diethyl-N'-(3-methylpyrazin-2-yl)ethane-1,2-diamine?
The IUPAC name of N,N'-diethyl-N'-(3-methylpyrazin-2-yl)ethane-1,2-diamine (CID 83064976) is N,N'-diethyl-N'-(3-methylpyrazin-2-yl)ethane-1,2-diamine.
What is the SMILES notation for N,N'-diethyl-N'-(3-methylpyrazin-2-yl)ethane-1,2-diamine?
The canonical SMILES for N,N'-diethyl-N'-(3-methylpyrazin-2-yl)ethane-1,2-diamine is CCNCCN(CC)c1nccnc1C.
What is the InChIKey of N,N'-diethyl-N'-(3-methylpyrazin-2-yl)ethane-1,2-diamine?
The InChIKey is QGQVABUZLKVHOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N4/c1-4-12-8-9-15(5-2)11-10(3)13-6-7-14-11/h6-7,12H,4-5,8-9H2,1-3H3.
What are the key properties of N,N'-diethyl-N'-(3-methylpyrazin-2-yl)ethane-1,2-diamine?
N,N'-diethyl-N'-(3-methylpyrazin-2-yl)ethane-1,2-diamine has a molecular weight of 208.31 g/mol, XLogP of 1.22, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-diethyl-N'-(3-methylpyrazin-2-yl)ethane-1,2-diamine is sourced from PubChem (CID 83064976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).