C18H26ClNO — CID 83067284
6-chloro-N-[3-(cyclopropylmethoxy)propyl]-2,2-dimethyl-1,3-dihydroinden-1-amine (PubChem CID 83067284) has the molecular formula C18H26ClNO and a molecular weight of 307.87 g/mol. Its IUPAC name is 6-chloro-N-[3-(cyclopropylmethoxy)propyl]-2,2-dimethyl-1,3-dihydroinden-1-amine.
| Compound Name | 6-chloro-N-[3-(cyclopropylmethoxy)propyl]-2,2-dimethyl-1,3-dihydroinden-1-amine |
|---|---|
| PubChem CID | 83067284 |
| Molecular Formula | C18H26ClNO |
| Molecular Weight | 307.87 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | 6-chloro-N-[3-(cyclopropylmethoxy)propyl]-2,2-dimethyl-1,3-dihydroinden-1-amine |
| SMILES | CC1(C)Cc2ccc(Cl)cc2C1NCCCOCC1CC1 |
| InChI | InChI=1S/C18H26ClNO/c1-18(2)11-14-6-7-15(19)10-16(14)17(18)20-8-3-9-21-12-13-4-5-13/h6-7,10,13,17,20H,3-5,8-9,11-12H2,1-2H3 |
| InChIKey | CWIXBGBZCLBTCJ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.87 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|