About N-(5-aminopentyl)-4,4,4-trifluorobutane-1-sulfonamide
N-(5-aminopentyl)-4,4,4-trifluorobutane-1-sulfonamide (PubChem CID 83067718) has the molecular formula C9H19F3N2O2S
and a molecular weight of 276.32 g/mol. Its IUPAC name is N-(5-aminopentyl)-4,4,4-trifluorobutane-1-sulfonamide.
Molecular Properties
| Compound Name | N-(5-aminopentyl)-4,4,4-trifluorobutane-1-sulfonamide |
| PubChem CID | 83067718 |
| Molecular Formula | C9H19F3N2O2S |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | N-(5-aminopentyl)-4,4,4-trifluorobutane-1-sulfonamide |
| SMILES | NCCCCCNS(=O)(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C9H19F3N2O2S/c10-9(11,12)5-4-8-17(15,16)14-7-3-1-2-6-13/h14H,1-8,13H2 |
| InChIKey | GKRRLJXKXVBIEY-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(5-aminopentyl)-4,4,4-trifluorobutane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-aminopentyl)-4,4,4-trifluorobutane-1-sulfonamide?
The IUPAC name of N-(5-aminopentyl)-4,4,4-trifluorobutane-1-sulfonamide (CID 83067718) is N-(5-aminopentyl)-4,4,4-trifluorobutane-1-sulfonamide.
What is the SMILES notation for N-(5-aminopentyl)-4,4,4-trifluorobutane-1-sulfonamide?
The canonical SMILES for N-(5-aminopentyl)-4,4,4-trifluorobutane-1-sulfonamide is NCCCCCNS(=O)(=O)CCCC(F)(F)F.
What is the InChIKey of N-(5-aminopentyl)-4,4,4-trifluorobutane-1-sulfonamide?
The InChIKey is GKRRLJXKXVBIEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19F3N2O2S/c10-9(11,12)5-4-8-17(15,16)14-7-3-1-2-6-13/h14H,1-8,13H2.
What are the key properties of N-(5-aminopentyl)-4,4,4-trifluorobutane-1-sulfonamide?
N-(5-aminopentyl)-4,4,4-trifluorobutane-1-sulfonamide has a molecular weight of 276.32 g/mol, XLogP of 1.38, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-aminopentyl)-4,4,4-trifluorobutane-1-sulfonamide is sourced from PubChem (CID 83067718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).