2-[cyclopentyl(4,4,4-trifluorobutylsulfonyl)amino]acetic acid

C11H18F3NO4S — CID 83067877

IUPAC2-[cyclopentyl(4,4,4-trifluorobutylsulfonyl)amino]acetic acid
SMILESO=C(O)CN(C1CCCC1)S(=O)(=O)CCCC(F)(F)F
InChIInChI=1S/C11H18F3NO4S/c12-11(13,14)6-3-7-20(18,19)15(8-10(16)17)9-4-1-2-5-9/h9H,1-8H2,(H,16,17)
InChIKeyZZPQNEFRILWSGJ-UHFFFAOYSA-N
MW317.33 g/mol
LogP1.99
Rot. Bonds7

About 2-[cyclopentyl(4,4,4-trifluorobutylsulfonyl)amino]acetic acid

2-[cyclopentyl(4,4,4-trifluorobutylsulfonyl)amino]acetic acid (PubChem CID 83067877) has the molecular formula C11H18F3NO4S and a molecular weight of 317.33 g/mol. Its IUPAC name is 2-[cyclopentyl(4,4,4-trifluorobutylsulfonyl)amino]acetic acid.

Molecular Properties

Compound Name2-[cyclopentyl(4,4,4-trifluorobutylsulfonyl)amino]acetic acid
PubChem CID83067877
Molecular FormulaC11H18F3NO4S
Molecular Weight317.33 g/mol
Exact Mass317.09
IUPAC Name2-[cyclopentyl(4,4,4-trifluorobutylsulfonyl)amino]acetic acid
SMILESO=C(O)CN(C1CCCC1)S(=O)(=O)CCCC(F)(F)F
InChIInChI=1S/C11H18F3NO4S/c12-11(13,14)6-3-7-20(18,19)15(8-10(16)17)9-4-1-2-5-9/h9H,1-8H2,(H,16,17)
InChIKeyZZPQNEFRILWSGJ-UHFFFAOYSA-N
XLogP1.99
TPSA74.68 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500317.33
LogP ≤ 51.99
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-[cyclopentyl(4,4,4-trifluorobutylsulfonyl)amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[cyclopentyl(4,4,4-trifluorobutylsulfonyl)amino]acetic acid?
The IUPAC name of 2-[cyclopentyl(4,4,4-trifluorobutylsulfonyl)amino]acetic acid (CID 83067877) is 2-[cyclopentyl(4,4,4-trifluorobutylsulfonyl)amino]acetic acid.
What is the SMILES notation for 2-[cyclopentyl(4,4,4-trifluorobutylsulfonyl)amino]acetic acid?
The canonical SMILES for 2-[cyclopentyl(4,4,4-trifluorobutylsulfonyl)amino]acetic acid is O=C(O)CN(C1CCCC1)S(=O)(=O)CCCC(F)(F)F.
What is the InChIKey of 2-[cyclopentyl(4,4,4-trifluorobutylsulfonyl)amino]acetic acid?
The InChIKey is ZZPQNEFRILWSGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18F3NO4S/c12-11(13,14)6-3-7-20(18,19)15(8-10(16)17)9-4-1-2-5-9/h9H,1-8H2,(H,16,17).
What are the key properties of 2-[cyclopentyl(4,4,4-trifluorobutylsulfonyl)amino]acetic acid?
2-[cyclopentyl(4,4,4-trifluorobutylsulfonyl)amino]acetic acid has a molecular weight of 317.33 g/mol, XLogP of 1.99, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[cyclopentyl(4,4,4-trifluorobutylsulfonyl)amino]acetic acid is sourced from PubChem (CID 83067877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).