C9H10F3N3O4S — CID 83067880
3-(4,4,4-trifluorobutylsulfonylamino)pyrazine-2-carboxylic acid (PubChem CID 83067880) has the molecular formula C9H10F3N3O4S and a molecular weight of 313.26 g/mol. Its IUPAC name is 3-(4,4,4-trifluorobutylsulfonylamino)pyrazine-2-carboxylic acid.
| Compound Name | 3-(4,4,4-trifluorobutylsulfonylamino)pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 83067880 |
| Molecular Formula | C9H10F3N3O4S |
| Molecular Weight | 313.26 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | 3-(4,4,4-trifluorobutylsulfonylamino)pyrazine-2-carboxylic acid |
| SMILES | O=C(O)c1nccnc1NS(=O)(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C9H10F3N3O4S/c10-9(11,12)2-1-5-20(18,19)15-7-6(8(16)17)13-3-4-14-7/h3-4H,1-2,5H2,(H,14,15)(H,16,17) |
| InChIKey | RZPUVTJFZSRLIX-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.26 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |