3-methyl-4-(4,4,4-trifluorobutylsulfonylamino)butanoic acid

C9H16F3NO4S — CID 83067884

IUPAC3-methyl-4-(4,4,4-trifluorobutylsulfonylamino)butanoic acid
SMILESCC(CNS(=O)(=O)CCCC(F)(F)F)CC(=O)O
InChIInChI=1S/C9H16F3NO4S/c1-7(5-8(14)15)6-13-18(16,17)4-2-3-9(10,11)12/h7,13H,2-6H2,1H3,(H,14,15)
InChIKeyZEEXKFHUDIHNAD-UHFFFAOYSA-N
MW291.29 g/mol
LogP1.36
Rot. Bonds8

About 3-methyl-4-(4,4,4-trifluorobutylsulfonylamino)butanoic acid

3-methyl-4-(4,4,4-trifluorobutylsulfonylamino)butanoic acid (PubChem CID 83067884) has the molecular formula C9H16F3NO4S and a molecular weight of 291.29 g/mol. Its IUPAC name is 3-methyl-4-(4,4,4-trifluorobutylsulfonylamino)butanoic acid.

Molecular Properties

Compound Name3-methyl-4-(4,4,4-trifluorobutylsulfonylamino)butanoic acid
PubChem CID83067884
Molecular FormulaC9H16F3NO4S
Molecular Weight291.29 g/mol
Exact Mass291.08
IUPAC Name3-methyl-4-(4,4,4-trifluorobutylsulfonylamino)butanoic acid
SMILESCC(CNS(=O)(=O)CCCC(F)(F)F)CC(=O)O
InChIInChI=1S/C9H16F3NO4S/c1-7(5-8(14)15)6-13-18(16,17)4-2-3-9(10,11)12/h7,13H,2-6H2,1H3,(H,14,15)
InChIKeyZEEXKFHUDIHNAD-UHFFFAOYSA-N
XLogP1.36
TPSA83.47 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds8
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500291.29
LogP ≤ 51.36
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 3-methyl-4-(4,4,4-trifluorobutylsulfonylamino)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-methyl-4-(4,4,4-trifluorobutylsulfonylamino)butanoic acid?
The IUPAC name of 3-methyl-4-(4,4,4-trifluorobutylsulfonylamino)butanoic acid (CID 83067884) is 3-methyl-4-(4,4,4-trifluorobutylsulfonylamino)butanoic acid.
What is the SMILES notation for 3-methyl-4-(4,4,4-trifluorobutylsulfonylamino)butanoic acid?
The canonical SMILES for 3-methyl-4-(4,4,4-trifluorobutylsulfonylamino)butanoic acid is CC(CNS(=O)(=O)CCCC(F)(F)F)CC(=O)O.
What is the InChIKey of 3-methyl-4-(4,4,4-trifluorobutylsulfonylamino)butanoic acid?
The InChIKey is ZEEXKFHUDIHNAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16F3NO4S/c1-7(5-8(14)15)6-13-18(16,17)4-2-3-9(10,11)12/h7,13H,2-6H2,1H3,(H,14,15).
What are the key properties of 3-methyl-4-(4,4,4-trifluorobutylsulfonylamino)butanoic acid?
3-methyl-4-(4,4,4-trifluorobutylsulfonylamino)butanoic acid has a molecular weight of 291.29 g/mol, XLogP of 1.36, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-4-(4,4,4-trifluorobutylsulfonylamino)butanoic acid is sourced from PubChem (CID 83067884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).