C11H12ClF3O — CID 83067903
5-(1-chloro-2,2,2-trifluoroethyl)-2-methoxy-1,3-dimethylbenzene (PubChem CID 83067903) has the molecular formula C11H12ClF3O and a molecular weight of 252.66 g/mol. Its IUPAC name is 5-(1-chloro-2,2,2-trifluoroethyl)-2-methoxy-1,3-dimethylbenzene.
| Compound Name | 5-(1-chloro-2,2,2-trifluoroethyl)-2-methoxy-1,3-dimethylbenzene |
|---|---|
| PubChem CID | 83067903 |
| Molecular Formula | C11H12ClF3O |
| Molecular Weight | 252.66 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 5-(1-chloro-2,2,2-trifluoroethyl)-2-methoxy-1,3-dimethylbenzene |
| SMILES | COc1c(C)cc(C(Cl)C(F)(F)F)cc1C |
| InChI | InChI=1S/C11H12ClF3O/c1-6-4-8(10(12)11(13,14)15)5-7(2)9(6)16-3/h4-5,10H,1-3H3 |
| InChIKey | VPIBUNIRNQNKHC-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.66 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|