About 4-methoxy-1-(4,4,4-trifluorobutylsulfonyl)pyrrolidine-2-carboxylic acid
4-methoxy-1-(4,4,4-trifluorobutylsulfonyl)pyrrolidine-2-carboxylic acid (PubChem CID 83068024) has the molecular formula C10H16F3NO5S
and a molecular weight of 319.30 g/mol. Its IUPAC name is 4-methoxy-1-(4,4,4-trifluorobutylsulfonyl)pyrrolidine-2-carboxylic acid.
Molecular Properties
| Compound Name | 4-methoxy-1-(4,4,4-trifluorobutylsulfonyl)pyrrolidine-2-carboxylic acid |
| PubChem CID | 83068024 |
| Molecular Formula | C10H16F3NO5S |
| Molecular Weight | 319.30 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 4-methoxy-1-(4,4,4-trifluorobutylsulfonyl)pyrrolidine-2-carboxylic acid |
| SMILES | COC1CC(C(=O)O)N(S(=O)(=O)CCCC(F)(F)F)C1 |
| InChI | InChI=1S/C10H16F3NO5S/c1-19-7-5-8(9(15)16)14(6-7)20(17,18)4-2-3-10(11,12)13/h7-8H,2-6H2,1H3,(H,15,16) |
| InChIKey | BUDPCVLDZLKIJA-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.30 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-methoxy-1-(4,4,4-trifluorobutylsulfonyl)pyrrolidine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-1-(4,4,4-trifluorobutylsulfonyl)pyrrolidine-2-carboxylic acid?
The IUPAC name of 4-methoxy-1-(4,4,4-trifluorobutylsulfonyl)pyrrolidine-2-carboxylic acid (CID 83068024) is 4-methoxy-1-(4,4,4-trifluorobutylsulfonyl)pyrrolidine-2-carboxylic acid.
What is the SMILES notation for 4-methoxy-1-(4,4,4-trifluorobutylsulfonyl)pyrrolidine-2-carboxylic acid?
The canonical SMILES for 4-methoxy-1-(4,4,4-trifluorobutylsulfonyl)pyrrolidine-2-carboxylic acid is COC1CC(C(=O)O)N(S(=O)(=O)CCCC(F)(F)F)C1.
What is the InChIKey of 4-methoxy-1-(4,4,4-trifluorobutylsulfonyl)pyrrolidine-2-carboxylic acid?
The InChIKey is BUDPCVLDZLKIJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16F3NO5S/c1-19-7-5-8(9(15)16)14(6-7)20(17,18)4-2-3-10(11,12)13/h7-8H,2-6H2,1H3,(H,15,16).
What are the key properties of 4-methoxy-1-(4,4,4-trifluorobutylsulfonyl)pyrrolidine-2-carboxylic acid?
4-methoxy-1-(4,4,4-trifluorobutylsulfonyl)pyrrolidine-2-carboxylic acid has a molecular weight of 319.30 g/mol, XLogP of 0.83, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-1-(4,4,4-trifluorobutylsulfonyl)pyrrolidine-2-carboxylic acid is sourced from PubChem (CID 83068024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).