About N-(3-aminopropyl)-4,4,4-trifluoro-N-propylbutane-1-sulfonamide
N-(3-aminopropyl)-4,4,4-trifluoro-N-propylbutane-1-sulfonamide (PubChem CID 83068088) has the molecular formula C10H21F3N2O2S
and a molecular weight of 290.35 g/mol. Its IUPAC name is N-(3-aminopropyl)-4,4,4-trifluoro-N-propylbutane-1-sulfonamide.
Molecular Properties
| Compound Name | N-(3-aminopropyl)-4,4,4-trifluoro-N-propylbutane-1-sulfonamide |
| PubChem CID | 83068088 |
| Molecular Formula | C10H21F3N2O2S |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | N-(3-aminopropyl)-4,4,4-trifluoro-N-propylbutane-1-sulfonamide |
| SMILES | CCCN(CCCN)S(=O)(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C10H21F3N2O2S/c1-2-7-15(8-4-6-14)18(16,17)9-3-5-10(11,12)13/h2-9,14H2,1H3 |
| InChIKey | OOXLSLIEXCFDAH-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(3-aminopropyl)-4,4,4-trifluoro-N-propylbutane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-aminopropyl)-4,4,4-trifluoro-N-propylbutane-1-sulfonamide?
The IUPAC name of N-(3-aminopropyl)-4,4,4-trifluoro-N-propylbutane-1-sulfonamide (CID 83068088) is N-(3-aminopropyl)-4,4,4-trifluoro-N-propylbutane-1-sulfonamide.
What is the SMILES notation for N-(3-aminopropyl)-4,4,4-trifluoro-N-propylbutane-1-sulfonamide?
The canonical SMILES for N-(3-aminopropyl)-4,4,4-trifluoro-N-propylbutane-1-sulfonamide is CCCN(CCCN)S(=O)(=O)CCCC(F)(F)F.
What is the InChIKey of N-(3-aminopropyl)-4,4,4-trifluoro-N-propylbutane-1-sulfonamide?
The InChIKey is OOXLSLIEXCFDAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21F3N2O2S/c1-2-7-15(8-4-6-14)18(16,17)9-3-5-10(11,12)13/h2-9,14H2,1H3.
What are the key properties of N-(3-aminopropyl)-4,4,4-trifluoro-N-propylbutane-1-sulfonamide?
N-(3-aminopropyl)-4,4,4-trifluoro-N-propylbutane-1-sulfonamide has a molecular weight of 290.35 g/mol, XLogP of 1.72, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-aminopropyl)-4,4,4-trifluoro-N-propylbutane-1-sulfonamide is sourced from PubChem (CID 83068088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).