About 2-(4,4,4-trifluorobutylsulfonylamino)pent-4-ynoic acid
2-(4,4,4-trifluorobutylsulfonylamino)pent-4-ynoic acid (PubChem CID 83068112) has the molecular formula C9H12F3NO4S
and a molecular weight of 287.26 g/mol. Its IUPAC name is 2-(4,4,4-trifluorobutylsulfonylamino)pent-4-ynoic acid.
Molecular Properties
| Compound Name | 2-(4,4,4-trifluorobutylsulfonylamino)pent-4-ynoic acid |
| PubChem CID | 83068112 |
| Molecular Formula | C9H12F3NO4S |
| Molecular Weight | 287.26 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | 2-(4,4,4-trifluorobutylsulfonylamino)pent-4-ynoic acid |
| SMILES | C#CCC(NS(=O)(=O)CCCC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C9H12F3NO4S/c1-2-4-7(8(14)15)13-18(16,17)6-3-5-9(10,11)12/h1,7,13H,3-6H2,(H,14,15) |
| InChIKey | UWWKOSLAYNLZCH-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.26 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(4,4,4-trifluorobutylsulfonylamino)pent-4-ynoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,4,4-trifluorobutylsulfonylamino)pent-4-ynoic acid?
The IUPAC name of 2-(4,4,4-trifluorobutylsulfonylamino)pent-4-ynoic acid (CID 83068112) is 2-(4,4,4-trifluorobutylsulfonylamino)pent-4-ynoic acid.
What is the SMILES notation for 2-(4,4,4-trifluorobutylsulfonylamino)pent-4-ynoic acid?
The canonical SMILES for 2-(4,4,4-trifluorobutylsulfonylamino)pent-4-ynoic acid is C#CCC(NS(=O)(=O)CCCC(F)(F)F)C(=O)O.
What is the InChIKey of 2-(4,4,4-trifluorobutylsulfonylamino)pent-4-ynoic acid?
The InChIKey is UWWKOSLAYNLZCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12F3NO4S/c1-2-4-7(8(14)15)13-18(16,17)6-3-5-9(10,11)12/h1,7,13H,3-6H2,(H,14,15).
What are the key properties of 2-(4,4,4-trifluorobutylsulfonylamino)pent-4-ynoic acid?
2-(4,4,4-trifluorobutylsulfonylamino)pent-4-ynoic acid has a molecular weight of 287.26 g/mol, XLogP of 0.72, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,4,4-trifluorobutylsulfonylamino)pent-4-ynoic acid is sourced from PubChem (CID 83068112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).