1-(4,4,4-trifluorobutylsulfonyl)piperidine-2-carboxylic acid

C10H16F3NO4S — CID 83068395

IUPAC1-(4,4,4-trifluorobutylsulfonyl)piperidine-2-carboxylic acid
SMILESO=C(O)C1CCCCN1S(=O)(=O)CCCC(F)(F)F
InChIInChI=1S/C10H16F3NO4S/c11-10(12,13)5-3-7-19(17,18)14-6-2-1-4-8(14)9(15)16/h8H,1-7H2,(H,15,16)
InChIKeyRDNRCVMAUBZXAX-UHFFFAOYSA-N
MW303.30 g/mol
LogP1.60
Rot. Bonds5

About 1-(4,4,4-trifluorobutylsulfonyl)piperidine-2-carboxylic acid

1-(4,4,4-trifluorobutylsulfonyl)piperidine-2-carboxylic acid (PubChem CID 83068395) has the molecular formula C10H16F3NO4S and a molecular weight of 303.30 g/mol. Its IUPAC name is 1-(4,4,4-trifluorobutylsulfonyl)piperidine-2-carboxylic acid.

Molecular Properties

Compound Name1-(4,4,4-trifluorobutylsulfonyl)piperidine-2-carboxylic acid
PubChem CID83068395
Molecular FormulaC10H16F3NO4S
Molecular Weight303.30 g/mol
Exact Mass303.08
IUPAC Name1-(4,4,4-trifluorobutylsulfonyl)piperidine-2-carboxylic acid
SMILESO=C(O)C1CCCCN1S(=O)(=O)CCCC(F)(F)F
InChIInChI=1S/C10H16F3NO4S/c11-10(12,13)5-3-7-19(17,18)14-6-2-1-4-8(14)9(15)16/h8H,1-7H2,(H,15,16)
InChIKeyRDNRCVMAUBZXAX-UHFFFAOYSA-N
XLogP1.60
TPSA74.68 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500303.30
LogP ≤ 51.60
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 1-(4,4,4-trifluorobutylsulfonyl)piperidine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(4,4,4-trifluorobutylsulfonyl)piperidine-2-carboxylic acid?
The IUPAC name of 1-(4,4,4-trifluorobutylsulfonyl)piperidine-2-carboxylic acid (CID 83068395) is 1-(4,4,4-trifluorobutylsulfonyl)piperidine-2-carboxylic acid.
What is the SMILES notation for 1-(4,4,4-trifluorobutylsulfonyl)piperidine-2-carboxylic acid?
The canonical SMILES for 1-(4,4,4-trifluorobutylsulfonyl)piperidine-2-carboxylic acid is O=C(O)C1CCCCN1S(=O)(=O)CCCC(F)(F)F.
What is the InChIKey of 1-(4,4,4-trifluorobutylsulfonyl)piperidine-2-carboxylic acid?
The InChIKey is RDNRCVMAUBZXAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16F3NO4S/c11-10(12,13)5-3-7-19(17,18)14-6-2-1-4-8(14)9(15)16/h8H,1-7H2,(H,15,16).
What are the key properties of 1-(4,4,4-trifluorobutylsulfonyl)piperidine-2-carboxylic acid?
1-(4,4,4-trifluorobutylsulfonyl)piperidine-2-carboxylic acid has a molecular weight of 303.30 g/mol, XLogP of 1.60, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,4,4-trifluorobutylsulfonyl)piperidine-2-carboxylic acid is sourced from PubChem (CID 83068395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).