About 3-[bromo-(4-methoxy-3,5-dimethylphenyl)methyl]oxolane
3-[bromo-(4-methoxy-3,5-dimethylphenyl)methyl]oxolane (PubChem CID 83068660) has the molecular formula C14H19BrO2
and a molecular weight of 299.21 g/mol. Its IUPAC name is 3-[bromo-(4-methoxy-3,5-dimethylphenyl)methyl]oxolane.
Molecular Properties
| Compound Name | 3-[bromo-(4-methoxy-3,5-dimethylphenyl)methyl]oxolane |
| PubChem CID | 83068660 |
| Molecular Formula | C14H19BrO2 |
| Molecular Weight | 299.21 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 3-[bromo-(4-methoxy-3,5-dimethylphenyl)methyl]oxolane |
| SMILES | COc1c(C)cc(C(Br)C2CCOC2)cc1C |
| InChI | InChI=1S/C14H19BrO2/c1-9-6-12(7-10(2)14(9)16-3)13(15)11-4-5-17-8-11/h6-7,11,13H,4-5,8H2,1-3H3 |
| InChIKey | NKBBAXUYYZBAAS-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.21 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-[bromo-(4-methoxy-3,5-dimethylphenyl)methyl]oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[bromo-(4-methoxy-3,5-dimethylphenyl)methyl]oxolane?
The IUPAC name of 3-[bromo-(4-methoxy-3,5-dimethylphenyl)methyl]oxolane (CID 83068660) is 3-[bromo-(4-methoxy-3,5-dimethylphenyl)methyl]oxolane.
What is the SMILES notation for 3-[bromo-(4-methoxy-3,5-dimethylphenyl)methyl]oxolane?
The canonical SMILES for 3-[bromo-(4-methoxy-3,5-dimethylphenyl)methyl]oxolane is COc1c(C)cc(C(Br)C2CCOC2)cc1C.
What is the InChIKey of 3-[bromo-(4-methoxy-3,5-dimethylphenyl)methyl]oxolane?
The InChIKey is NKBBAXUYYZBAAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19BrO2/c1-9-6-12(7-10(2)14(9)16-3)13(15)11-4-5-17-8-11/h6-7,11,13H,4-5,8H2,1-3H3.
What are the key properties of 3-[bromo-(4-methoxy-3,5-dimethylphenyl)methyl]oxolane?
3-[bromo-(4-methoxy-3,5-dimethylphenyl)methyl]oxolane has a molecular weight of 299.21 g/mol, XLogP of 3.78, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[bromo-(4-methoxy-3,5-dimethylphenyl)methyl]oxolane is sourced from PubChem (CID 83068660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).