C10H12F3NO4S2 — CID 83068848
2-thiophen-2-yl-2-(4,4,4-trifluorobutylsulfonylamino)acetic acid (PubChem CID 83068848) has the molecular formula C10H12F3NO4S2 and a molecular weight of 331.34 g/mol. Its IUPAC name is 2-thiophen-2-yl-2-(4,4,4-trifluorobutylsulfonylamino)acetic acid.
| Compound Name | 2-thiophen-2-yl-2-(4,4,4-trifluorobutylsulfonylamino)acetic acid |
|---|---|
| PubChem CID | 83068848 |
| Molecular Formula | C10H12F3NO4S2 |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | 2-thiophen-2-yl-2-(4,4,4-trifluorobutylsulfonylamino)acetic acid |
| SMILES | O=C(O)C(NS(=O)(=O)CCCC(F)(F)F)c1cccs1 |
| InChI | InChI=1S/C10H12F3NO4S2/c11-10(12,13)4-2-6-20(17,18)14-8(9(15)16)7-3-1-5-19-7/h1,3,5,8,14H,2,4,6H2,(H,15,16) |
| InChIKey | AXNCQPQETYIZIX-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |