C18H19FO — CID 83069257
4-fluoro-1-(2,4,5-trimethylphenyl)-2,3-dihydroinden-1-ol (PubChem CID 83069257) has the molecular formula C18H19FO and a molecular weight of 270.35 g/mol. Its IUPAC name is 4-fluoro-1-(2,4,5-trimethylphenyl)-2,3-dihydroinden-1-ol.
| Compound Name | 4-fluoro-1-(2,4,5-trimethylphenyl)-2,3-dihydroinden-1-ol |
|---|---|
| PubChem CID | 83069257 |
| Molecular Formula | C18H19FO |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 4-fluoro-1-(2,4,5-trimethylphenyl)-2,3-dihydroinden-1-ol |
| SMILES | Cc1cc(C)c(C2(O)CCc3c(F)cccc32)cc1C |
| InChI | InChI=1S/C18H19FO/c1-11-9-13(3)16(10-12(11)2)18(20)8-7-14-15(18)5-4-6-17(14)19/h4-6,9-10,20H,7-8H2,1-3H3 |
| InChIKey | CVOUPDCOSFECQB-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |