About 4-(4-fluoro-1-hydroxy-2,3-dihydroinden-1-yl)oxane-4-carbonitrile
4-(4-fluoro-1-hydroxy-2,3-dihydroinden-1-yl)oxane-4-carbonitrile (PubChem CID 83069363) has the molecular formula C15H16FNO2
and a molecular weight of 261.30 g/mol. Its IUPAC name is 4-(4-fluoro-1-hydroxy-2,3-dihydroinden-1-yl)oxane-4-carbonitrile.
Molecular Properties
| Compound Name | 4-(4-fluoro-1-hydroxy-2,3-dihydroinden-1-yl)oxane-4-carbonitrile |
| PubChem CID | 83069363 |
| Molecular Formula | C15H16FNO2 |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 4-(4-fluoro-1-hydroxy-2,3-dihydroinden-1-yl)oxane-4-carbonitrile |
| SMILES | N#CC1(C2(O)CCc3c(F)cccc32)CCOCC1 |
| InChI | InChI=1S/C15H16FNO2/c16-13-3-1-2-12-11(13)4-5-15(12,18)14(10-17)6-8-19-9-7-14/h1-3,18H,4-9H2 |
| InChIKey | WLQWPVKPGKCTML-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(4-fluoro-1-hydroxy-2,3-dihydroinden-1-yl)oxane-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-fluoro-1-hydroxy-2,3-dihydroinden-1-yl)oxane-4-carbonitrile?
The IUPAC name of 4-(4-fluoro-1-hydroxy-2,3-dihydroinden-1-yl)oxane-4-carbonitrile (CID 83069363) is 4-(4-fluoro-1-hydroxy-2,3-dihydroinden-1-yl)oxane-4-carbonitrile.
What is the SMILES notation for 4-(4-fluoro-1-hydroxy-2,3-dihydroinden-1-yl)oxane-4-carbonitrile?
The canonical SMILES for 4-(4-fluoro-1-hydroxy-2,3-dihydroinden-1-yl)oxane-4-carbonitrile is N#CC1(C2(O)CCc3c(F)cccc32)CCOCC1.
What is the InChIKey of 4-(4-fluoro-1-hydroxy-2,3-dihydroinden-1-yl)oxane-4-carbonitrile?
The InChIKey is WLQWPVKPGKCTML-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16FNO2/c16-13-3-1-2-12-11(13)4-5-15(12,18)14(10-17)6-8-19-9-7-14/h1-3,18H,4-9H2.
What are the key properties of 4-(4-fluoro-1-hydroxy-2,3-dihydroinden-1-yl)oxane-4-carbonitrile?
4-(4-fluoro-1-hydroxy-2,3-dihydroinden-1-yl)oxane-4-carbonitrile has a molecular weight of 261.30 g/mol, XLogP of 2.28, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-fluoro-1-hydroxy-2,3-dihydroinden-1-yl)oxane-4-carbonitrile is sourced from PubChem (CID 83069363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).