C17H17ClFN — CID 83069385
N-[1-(4-chloro-3-fluorophenyl)ethyl]-2-phenylcyclopropan-1-amine (PubChem CID 83069385) has the molecular formula C17H17ClFN and a molecular weight of 289.78 g/mol. Its IUPAC name is N-[1-(4-chloro-3-fluorophenyl)ethyl]-2-phenylcyclopropan-1-amine.
| Compound Name | N-[1-(4-chloro-3-fluorophenyl)ethyl]-2-phenylcyclopropan-1-amine |
|---|---|
| PubChem CID | 83069385 |
| Molecular Formula | C17H17ClFN |
| Molecular Weight | 289.78 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | N-[1-(4-chloro-3-fluorophenyl)ethyl]-2-phenylcyclopropan-1-amine |
| SMILES | CC(NC1CC1c1ccccc1)c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C17H17ClFN/c1-11(13-7-8-15(18)16(19)9-13)20-17-10-14(17)12-5-3-2-4-6-12/h2-9,11,14,17,20H,10H2,1H3 |
| InChIKey | HNVUQPTZCVXJBO-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.78 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |