About 1-[(2,4-dichlorophenyl)methyl]-4-fluoro-2,3-dihydroinden-1-ol
1-[(2,4-dichlorophenyl)methyl]-4-fluoro-2,3-dihydroinden-1-ol (PubChem CID 83069879) has the molecular formula C16H13Cl2FO
and a molecular weight of 311.18 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)methyl]-4-fluoro-2,3-dihydroinden-1-ol.
Molecular Properties
| Compound Name | 1-[(2,4-dichlorophenyl)methyl]-4-fluoro-2,3-dihydroinden-1-ol |
| PubChem CID | 83069879 |
| Molecular Formula | C16H13Cl2FO |
| Molecular Weight | 311.18 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methyl]-4-fluoro-2,3-dihydroinden-1-ol |
| SMILES | OC1(Cc2ccc(Cl)cc2Cl)CCc2c(F)cccc21 |
| InChI | InChI=1S/C16H13Cl2FO/c17-11-5-4-10(14(18)8-11)9-16(20)7-6-12-13(16)2-1-3-15(12)19/h1-5,8,20H,6-7,9H2 |
| InChIKey | HNMLWSGXIVACPT-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.18 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[(2,4-dichlorophenyl)methyl]-4-fluoro-2,3-dihydroinden-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2,4-dichlorophenyl)methyl]-4-fluoro-2,3-dihydroinden-1-ol?
The IUPAC name of 1-[(2,4-dichlorophenyl)methyl]-4-fluoro-2,3-dihydroinden-1-ol (CID 83069879) is 1-[(2,4-dichlorophenyl)methyl]-4-fluoro-2,3-dihydroinden-1-ol.
What is the SMILES notation for 1-[(2,4-dichlorophenyl)methyl]-4-fluoro-2,3-dihydroinden-1-ol?
The canonical SMILES for 1-[(2,4-dichlorophenyl)methyl]-4-fluoro-2,3-dihydroinden-1-ol is OC1(Cc2ccc(Cl)cc2Cl)CCc2c(F)cccc21.
What is the InChIKey of 1-[(2,4-dichlorophenyl)methyl]-4-fluoro-2,3-dihydroinden-1-ol?
The InChIKey is HNMLWSGXIVACPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13Cl2FO/c17-11-5-4-10(14(18)8-11)9-16(20)7-6-12-13(16)2-1-3-15(12)19/h1-5,8,20H,6-7,9H2.
What are the key properties of 1-[(2,4-dichlorophenyl)methyl]-4-fluoro-2,3-dihydroinden-1-ol?
1-[(2,4-dichlorophenyl)methyl]-4-fluoro-2,3-dihydroinden-1-ol has a molecular weight of 311.18 g/mol, XLogP of 4.51, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2,4-dichlorophenyl)methyl]-4-fluoro-2,3-dihydroinden-1-ol is sourced from PubChem (CID 83069879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).