About 1-(3,4-difluorophenyl)-4-fluoro-2,3-dihydroinden-1-ol
1-(3,4-difluorophenyl)-4-fluoro-2,3-dihydroinden-1-ol (PubChem CID 83070046) has the molecular formula C15H11F3O
and a molecular weight of 264.25 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-4-fluoro-2,3-dihydroinden-1-ol.
Molecular Properties
| Compound Name | 1-(3,4-difluorophenyl)-4-fluoro-2,3-dihydroinden-1-ol |
| PubChem CID | 83070046 |
| Molecular Formula | C15H11F3O |
| Molecular Weight | 264.25 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 1-(3,4-difluorophenyl)-4-fluoro-2,3-dihydroinden-1-ol |
| SMILES | OC1(c2ccc(F)c(F)c2)CCc2c(F)cccc21 |
| InChI | InChI=1S/C15H11F3O/c16-12-3-1-2-11-10(12)6-7-15(11,19)9-4-5-13(17)14(18)8-9/h1-5,8,19H,6-7H2 |
| InChIKey | XXGKVKFGDDRXAL-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.25 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(3,4-difluorophenyl)-4-fluoro-2,3-dihydroinden-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-difluorophenyl)-4-fluoro-2,3-dihydroinden-1-ol?
The IUPAC name of 1-(3,4-difluorophenyl)-4-fluoro-2,3-dihydroinden-1-ol (CID 83070046) is 1-(3,4-difluorophenyl)-4-fluoro-2,3-dihydroinden-1-ol.
What is the SMILES notation for 1-(3,4-difluorophenyl)-4-fluoro-2,3-dihydroinden-1-ol?
The canonical SMILES for 1-(3,4-difluorophenyl)-4-fluoro-2,3-dihydroinden-1-ol is OC1(c2ccc(F)c(F)c2)CCc2c(F)cccc21.
What is the InChIKey of 1-(3,4-difluorophenyl)-4-fluoro-2,3-dihydroinden-1-ol?
The InChIKey is XXGKVKFGDDRXAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11F3O/c16-12-3-1-2-11-10(12)6-7-15(11,19)9-4-5-13(17)14(18)8-9/h1-5,8,19H,6-7H2.
What are the key properties of 1-(3,4-difluorophenyl)-4-fluoro-2,3-dihydroinden-1-ol?
1-(3,4-difluorophenyl)-4-fluoro-2,3-dihydroinden-1-ol has a molecular weight of 264.25 g/mol, XLogP of 3.29, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-difluorophenyl)-4-fluoro-2,3-dihydroinden-1-ol is sourced from PubChem (CID 83070046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).