About 7-fluoro-1'-(2-methoxyethyl)spiro[1,2-dihydroindene-3,5'-4H-imidazole]-2'-amine
7-fluoro-1'-(2-methoxyethyl)spiro[1,2-dihydroindene-3,5'-4H-imidazole]-2'-amine (PubChem CID 83070077) has the molecular formula C14H18FN3O
and a molecular weight of 263.32 g/mol. Its IUPAC name is 7-fluoro-1'-(2-methoxyethyl)spiro[1,2-dihydroindene-3,5'-4H-imidazole]-2'-amine.
Molecular Properties
| Compound Name | 7-fluoro-1'-(2-methoxyethyl)spiro[1,2-dihydroindene-3,5'-4H-imidazole]-2'-amine |
| PubChem CID | 83070077 |
| Molecular Formula | C14H18FN3O |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 7-fluoro-1'-(2-methoxyethyl)spiro[1,2-dihydroindene-3,5'-4H-imidazole]-2'-amine |
| SMILES | COCCN1C(N)=NCC12CCc1c(F)cccc12 |
| InChI | InChI=1S/C14H18FN3O/c1-19-8-7-18-13(16)17-9-14(18)6-5-10-11(14)3-2-4-12(10)15/h2-4H,5-9H2,1H3,(H2,16,17) |
| InChIKey | GTPNFAHCTSJTER-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-fluoro-1'-(2-methoxyethyl)spiro[1,2-dihydroindene-3,5'-4H-imidazole]-2'-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-1'-(2-methoxyethyl)spiro[1,2-dihydroindene-3,5'-4H-imidazole]-2'-amine?
The IUPAC name of 7-fluoro-1'-(2-methoxyethyl)spiro[1,2-dihydroindene-3,5'-4H-imidazole]-2'-amine (CID 83070077) is 7-fluoro-1'-(2-methoxyethyl)spiro[1,2-dihydroindene-3,5'-4H-imidazole]-2'-amine.
What is the SMILES notation for 7-fluoro-1'-(2-methoxyethyl)spiro[1,2-dihydroindene-3,5'-4H-imidazole]-2'-amine?
The canonical SMILES for 7-fluoro-1'-(2-methoxyethyl)spiro[1,2-dihydroindene-3,5'-4H-imidazole]-2'-amine is COCCN1C(N)=NCC12CCc1c(F)cccc12.
What is the InChIKey of 7-fluoro-1'-(2-methoxyethyl)spiro[1,2-dihydroindene-3,5'-4H-imidazole]-2'-amine?
The InChIKey is GTPNFAHCTSJTER-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18FN3O/c1-19-8-7-18-13(16)17-9-14(18)6-5-10-11(14)3-2-4-12(10)15/h2-4H,5-9H2,1H3,(H2,16,17).
What are the key properties of 7-fluoro-1'-(2-methoxyethyl)spiro[1,2-dihydroindene-3,5'-4H-imidazole]-2'-amine?
7-fluoro-1'-(2-methoxyethyl)spiro[1,2-dihydroindene-3,5'-4H-imidazole]-2'-amine has a molecular weight of 263.32 g/mol, XLogP of 1.24, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-1'-(2-methoxyethyl)spiro[1,2-dihydroindene-3,5'-4H-imidazole]-2'-amine is sourced from PubChem (CID 83070077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).