C15H20ClF2NO2 — CID 83073637
1-(2-chloro-4,6-difluoroanilino)-3-cyclohexyloxypropan-2-ol (PubChem CID 83073637) has the molecular formula C15H20ClF2NO2 and a molecular weight of 319.78 g/mol. Its IUPAC name is 1-(2-chloro-4,6-difluoroanilino)-3-cyclohexyloxypropan-2-ol.
| Compound Name | 1-(2-chloro-4,6-difluoroanilino)-3-cyclohexyloxypropan-2-ol |
|---|---|
| PubChem CID | 83073637 |
| Molecular Formula | C15H20ClF2NO2 |
| Molecular Weight | 319.78 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 1-(2-chloro-4,6-difluoroanilino)-3-cyclohexyloxypropan-2-ol |
| SMILES | OC(CNc1c(F)cc(F)cc1Cl)COC1CCCCC1 |
| InChI | InChI=1S/C15H20ClF2NO2/c16-13-6-10(17)7-14(18)15(13)19-8-11(20)9-21-12-4-2-1-3-5-12/h6-7,11-12,19-20H,1-5,8-9H2 |
| InChIKey | FZGPHJKTOHQIAV-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.78 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |