C14H12Cl2FN3O — CID 83074778
N-(2,6-dichloro-4-fluorophenyl)-4-hydrazinyl-3-methylbenzamide (PubChem CID 83074778) has the molecular formula C14H12Cl2FN3O and a molecular weight of 328.17 g/mol. Its IUPAC name is N-(2,6-dichloro-4-fluorophenyl)-4-hydrazinyl-3-methylbenzamide.
| Compound Name | N-(2,6-dichloro-4-fluorophenyl)-4-hydrazinyl-3-methylbenzamide |
|---|---|
| PubChem CID | 83074778 |
| Molecular Formula | C14H12Cl2FN3O |
| Molecular Weight | 328.17 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | N-(2,6-dichloro-4-fluorophenyl)-4-hydrazinyl-3-methylbenzamide |
| SMILES | Cc1cc(C(=O)Nc2c(Cl)cc(F)cc2Cl)ccc1NN |
| InChI | InChI=1S/C14H12Cl2FN3O/c1-7-4-8(2-3-12(7)20-18)14(21)19-13-10(15)5-9(17)6-11(13)16/h2-6,20H,18H2,1H3,(H,19,21) |
| InChIKey | YZCGKULGHJKMJZ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.17 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|