C13H20FNO3 — CID 83075210
N-[1-(4-fluoro-3-methoxyphenyl)ethyl]-2,2-dimethoxyethanamine (PubChem CID 83075210) has the molecular formula C13H20FNO3 and a molecular weight of 257.31 g/mol. Its IUPAC name is N-[1-(4-fluoro-3-methoxyphenyl)ethyl]-2,2-dimethoxyethanamine.
| Compound Name | N-[1-(4-fluoro-3-methoxyphenyl)ethyl]-2,2-dimethoxyethanamine |
|---|---|
| PubChem CID | 83075210 |
| Molecular Formula | C13H20FNO3 |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | N-[1-(4-fluoro-3-methoxyphenyl)ethyl]-2,2-dimethoxyethanamine |
| SMILES | COc1cc(C(C)NCC(OC)OC)ccc1F |
| InChI | InChI=1S/C13H20FNO3/c1-9(15-8-13(17-3)18-4)10-5-6-11(14)12(7-10)16-2/h5-7,9,13,15H,8H2,1-4H3 |
| InChIKey | GJHOULNPNQPKIX-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|