C17H19NO2 — CID 83076109
4-[1-hydroxy-1-(1,2,3,4-tetrahydroquinolin-2-yl)ethyl]phenol (PubChem CID 83076109) has the molecular formula C17H19NO2 and a molecular weight of 269.34 g/mol. Its IUPAC name is 4-[1-hydroxy-1-(1,2,3,4-tetrahydroquinolin-2-yl)ethyl]phenol.
| Compound Name | 4-[1-hydroxy-1-(1,2,3,4-tetrahydroquinolin-2-yl)ethyl]phenol |
|---|---|
| PubChem CID | 83076109 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 4-[1-hydroxy-1-(1,2,3,4-tetrahydroquinolin-2-yl)ethyl]phenol |
| SMILES | CC(O)(c1ccc(O)cc1)C1CCc2ccccc2N1 |
| InChI | InChI=1S/C17H19NO2/c1-17(20,13-7-9-14(19)10-8-13)16-11-6-12-4-2-3-5-15(12)18-16/h2-5,7-10,16,18-20H,6,11H2,1H3 |
| InChIKey | PBYFFOSYCHXXAV-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |