C12H12ClN5 — CID 83076611
2-chloro-6-(3,5-diethyl-1,2,4-triazol-1-yl)pyridine-4-carbonitrile (PubChem CID 83076611) has the molecular formula C12H12ClN5 and a molecular weight of 261.72 g/mol. Its IUPAC name is 2-chloro-6-(3,5-diethyl-1,2,4-triazol-1-yl)pyridine-4-carbonitrile.
| Compound Name | 2-chloro-6-(3,5-diethyl-1,2,4-triazol-1-yl)pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 83076611 |
| Molecular Formula | C12H12ClN5 |
| Molecular Weight | 261.72 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 2-chloro-6-(3,5-diethyl-1,2,4-triazol-1-yl)pyridine-4-carbonitrile |
| SMILES | CCc1nc(CC)n(-c2cc(C#N)cc(Cl)n2)n1 |
| InChI | InChI=1S/C12H12ClN5/c1-3-10-16-11(4-2)18(17-10)12-6-8(7-14)5-9(13)15-12/h5-6H,3-4H2,1-2H3 |
| InChIKey | UEBHAKWNULIHDH-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 67.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.72 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|