C16H20ClN3 — CID 83077251
2-chloro-6-[(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]pyridine-4-carbonitrile (PubChem CID 83077251) has the molecular formula C16H20ClN3 and a molecular weight of 289.81 g/mol. Its IUPAC name is 2-chloro-6-[(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]pyridine-4-carbonitrile.
| Compound Name | 2-chloro-6-[(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 83077251 |
| Molecular Formula | C16H20ClN3 |
| Molecular Weight | 289.81 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 2-chloro-6-[(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]pyridine-4-carbonitrile |
| SMILES | CC12CCC(C1)C(C)(C)C2Nc1cc(C#N)cc(Cl)n1 |
| InChI | InChI=1S/C16H20ClN3/c1-15(2)11-4-5-16(3,8-11)14(15)20-13-7-10(9-18)6-12(17)19-13/h6-7,11,14H,4-5,8H2,1-3H3,(H,19,20) |
| InChIKey | MUFHHLQHEKQYOJ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.81 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|