C14H11Cl2FN2O — CID 83077384
3-[(2,6-dichloro-4-fluoroanilino)methyl]benzamide (PubChem CID 83077384) has the molecular formula C14H11Cl2FN2O and a molecular weight of 313.16 g/mol. Its IUPAC name is 3-[(2,6-dichloro-4-fluoroanilino)methyl]benzamide.
| Compound Name | 3-[(2,6-dichloro-4-fluoroanilino)methyl]benzamide |
|---|---|
| PubChem CID | 83077384 |
| Molecular Formula | C14H11Cl2FN2O |
| Molecular Weight | 313.16 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | 3-[(2,6-dichloro-4-fluoroanilino)methyl]benzamide |
| SMILES | NC(=O)c1cccc(CNc2c(Cl)cc(F)cc2Cl)c1 |
| InChI | InChI=1S/C14H11Cl2FN2O/c15-11-5-10(17)6-12(16)13(11)19-7-8-2-1-3-9(4-8)14(18)20/h1-6,19H,7H2,(H2,18,20) |
| InChIKey | XZWNGGXAJCXUNA-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.16 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |