About 2-chloro-6-[1-(1,3-thiazol-2-yl)ethylamino]pyridine-4-carbonitrile
2-chloro-6-[1-(1,3-thiazol-2-yl)ethylamino]pyridine-4-carbonitrile (PubChem CID 83077497) has the molecular formula C11H9ClN4S
and a molecular weight of 264.74 g/mol. Its IUPAC name is 2-chloro-6-[1-(1,3-thiazol-2-yl)ethylamino]pyridine-4-carbonitrile.
Molecular Properties
| Compound Name | 2-chloro-6-[1-(1,3-thiazol-2-yl)ethylamino]pyridine-4-carbonitrile |
| PubChem CID | 83077497 |
| Molecular Formula | C11H9ClN4S |
| Molecular Weight | 264.74 g/mol |
| Exact Mass | 264.02 |
| IUPAC Name | 2-chloro-6-[1-(1,3-thiazol-2-yl)ethylamino]pyridine-4-carbonitrile |
| SMILES | CC(Nc1cc(C#N)cc(Cl)n1)c1nccs1 |
| InChI | InChI=1S/C11H9ClN4S/c1-7(11-14-2-3-17-11)15-10-5-8(6-13)4-9(12)16-10/h2-5,7H,1H3,(H,15,16) |
| InChIKey | WVXABLGQKNAYBA-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.74 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-6-[1-(1,3-thiazol-2-yl)ethylamino]pyridine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-6-[1-(1,3-thiazol-2-yl)ethylamino]pyridine-4-carbonitrile?
The IUPAC name of 2-chloro-6-[1-(1,3-thiazol-2-yl)ethylamino]pyridine-4-carbonitrile (CID 83077497) is 2-chloro-6-[1-(1,3-thiazol-2-yl)ethylamino]pyridine-4-carbonitrile.
What is the SMILES notation for 2-chloro-6-[1-(1,3-thiazol-2-yl)ethylamino]pyridine-4-carbonitrile?
The canonical SMILES for 2-chloro-6-[1-(1,3-thiazol-2-yl)ethylamino]pyridine-4-carbonitrile is CC(Nc1cc(C#N)cc(Cl)n1)c1nccs1.
What is the InChIKey of 2-chloro-6-[1-(1,3-thiazol-2-yl)ethylamino]pyridine-4-carbonitrile?
The InChIKey is WVXABLGQKNAYBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9ClN4S/c1-7(11-14-2-3-17-11)15-10-5-8(6-13)4-9(12)16-10/h2-5,7H,1H3,(H,15,16).
What are the key properties of 2-chloro-6-[1-(1,3-thiazol-2-yl)ethylamino]pyridine-4-carbonitrile?
2-chloro-6-[1-(1,3-thiazol-2-yl)ethylamino]pyridine-4-carbonitrile has a molecular weight of 264.74 g/mol, XLogP of 3.24, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-6-[1-(1,3-thiazol-2-yl)ethylamino]pyridine-4-carbonitrile is sourced from PubChem (CID 83077497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).