C8H4Cl2FN3S2 — CID 83077981
5-(2,6-dichloro-4-fluoroanilino)-3H-1,3,4-thiadiazole-2-thione (PubChem CID 83077981) has the molecular formula C8H4Cl2FN3S2 and a molecular weight of 296.18 g/mol. Its IUPAC name is 5-(2,6-dichloro-4-fluoroanilino)-3H-1,3,4-thiadiazole-2-thione.
| Compound Name | 5-(2,6-dichloro-4-fluoroanilino)-3H-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 83077981 |
| Molecular Formula | C8H4Cl2FN3S2 |
| Molecular Weight | 296.18 g/mol |
| Exact Mass | 294.92 |
| IUPAC Name | 5-(2,6-dichloro-4-fluoroanilino)-3H-1,3,4-thiadiazole-2-thione |
| SMILES | Fc1cc(Cl)c(Nc2n[nH]c(=S)s2)c(Cl)c1 |
| InChI | InChI=1S/C8H4Cl2FN3S2/c9-4-1-3(11)2-5(10)6(4)12-7-13-14-8(15)16-7/h1-2H,(H,12,13)(H,14,15) |
| InChIKey | CAUGJMXICKLXSG-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.18 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|