C10H8Cl2FN3S — CID 83078276
4-(2,6-dichloro-4-fluorophenyl)-3-ethyl-1H-1,2,4-triazole-5-thione (PubChem CID 83078276) has the molecular formula C10H8Cl2FN3S and a molecular weight of 292.17 g/mol. Its IUPAC name is 4-(2,6-dichloro-4-fluorophenyl)-3-ethyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-(2,6-dichloro-4-fluorophenyl)-3-ethyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 83078276 |
| Molecular Formula | C10H8Cl2FN3S |
| Molecular Weight | 292.17 g/mol |
| Exact Mass | 290.98 |
| IUPAC Name | 4-(2,6-dichloro-4-fluorophenyl)-3-ethyl-1H-1,2,4-triazole-5-thione |
| SMILES | CCc1n[nH]c(=S)n1-c1c(Cl)cc(F)cc1Cl |
| InChI | InChI=1S/C10H8Cl2FN3S/c1-2-8-14-15-10(17)16(8)9-6(11)3-5(13)4-7(9)12/h3-4H,2H2,1H3,(H,15,17) |
| InChIKey | BSDOESNDNATISW-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.17 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|