C16H11Cl2FN2 — CID 83078319
2,6-dichloro-4-fluoro-N-(quinolin-4-ylmethyl)aniline (PubChem CID 83078319) has the molecular formula C16H11Cl2FN2 and a molecular weight of 321.18 g/mol. Its IUPAC name is 2,6-dichloro-4-fluoro-N-(quinolin-4-ylmethyl)aniline.
| Compound Name | 2,6-dichloro-4-fluoro-N-(quinolin-4-ylmethyl)aniline |
|---|---|
| PubChem CID | 83078319 |
| Molecular Formula | C16H11Cl2FN2 |
| Molecular Weight | 321.18 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | 2,6-dichloro-4-fluoro-N-(quinolin-4-ylmethyl)aniline |
| SMILES | Fc1cc(Cl)c(NCc2ccnc3ccccc23)c(Cl)c1 |
| InChI | InChI=1S/C16H11Cl2FN2/c17-13-7-11(19)8-14(18)16(13)21-9-10-5-6-20-15-4-2-1-3-12(10)15/h1-8,21H,9H2 |
| InChIKey | SBIXQZTYRGIINW-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.18 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |