About (2-chloro-4,6-difluorophenyl)thiourea
(2-chloro-4,6-difluorophenyl)thiourea (PubChem CID 83081180) has the molecular formula C7H5ClF2N2S
and a molecular weight of 222.65 g/mol. Its IUPAC name is (2-chloro-4,6-difluorophenyl)thiourea.
Molecular Properties
| Compound Name | (2-chloro-4,6-difluorophenyl)thiourea |
| PubChem CID | 83081180 |
| Molecular Formula | C7H5ClF2N2S |
| Molecular Weight | 222.65 g/mol |
| Exact Mass | 221.98 |
| IUPAC Name | (2-chloro-4,6-difluorophenyl)thiourea |
| SMILES | NC(=S)Nc1c(F)cc(F)cc1Cl |
| InChI | InChI=1S/C7H5ClF2N2S/c8-4-1-3(9)2-5(10)6(4)12-7(11)13/h1-2H,(H3,11,12,13) |
| InChIKey | HDEWOQJRZLQTFG-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.65 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (2-chloro-4,6-difluorophenyl)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chloro-4,6-difluorophenyl)thiourea?
The IUPAC name of (2-chloro-4,6-difluorophenyl)thiourea (CID 83081180) is (2-chloro-4,6-difluorophenyl)thiourea.
What is the SMILES notation for (2-chloro-4,6-difluorophenyl)thiourea?
The canonical SMILES for (2-chloro-4,6-difluorophenyl)thiourea is NC(=S)Nc1c(F)cc(F)cc1Cl.
What is the InChIKey of (2-chloro-4,6-difluorophenyl)thiourea?
The InChIKey is HDEWOQJRZLQTFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClF2N2S/c8-4-1-3(9)2-5(10)6(4)12-7(11)13/h1-2H,(H3,11,12,13).
What are the key properties of (2-chloro-4,6-difluorophenyl)thiourea?
(2-chloro-4,6-difluorophenyl)thiourea has a molecular weight of 222.65 g/mol, XLogP of 2.27, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chloro-4,6-difluorophenyl)thiourea is sourced from PubChem (CID 83081180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).