C12H17NO3 — CID 83082533
methyl 1-(furan-3-ylmethyl)-4-methylpyrrolidine-3-carboxylate (PubChem CID 83082533) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is methyl 1-(furan-3-ylmethyl)-4-methylpyrrolidine-3-carboxylate.
| Compound Name | methyl 1-(furan-3-ylmethyl)-4-methylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 83082533 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | methyl 1-(furan-3-ylmethyl)-4-methylpyrrolidine-3-carboxylate |
| SMILES | COC(=O)C1CN(Cc2ccoc2)CC1C |
| InChI | InChI=1S/C12H17NO3/c1-9-5-13(6-10-3-4-16-8-10)7-11(9)12(14)15-2/h3-4,8-9,11H,5-7H2,1-2H3 |
| InChIKey | YFWMQNWQIYPFBF-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |