C11H11FN6OS — CID 83082863
[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]methyl N-(diaminomethylidene)carbamimidothioate (PubChem CID 83082863) has the molecular formula C11H11FN6OS and a molecular weight of 294.32 g/mol. Its IUPAC name is [5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]methyl N-(diaminomethylidene)carbamimidothioate.
| Compound Name | [5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]methyl N-(diaminomethylidene)carbamimidothioate |
|---|---|
| PubChem CID | 83082863 |
| Molecular Formula | C11H11FN6OS |
| Molecular Weight | 294.32 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | [5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]methyl N-(diaminomethylidene)carbamimidothioate |
| SMILES | [H]/N=C(\N=C(N)N)SCc1nnc(-c2ccc(F)cc2)o1 |
| InChI | InChI=1S/C11H11FN6OS/c12-7-3-1-6(2-4-7)9-18-17-8(19-9)5-20-11(15)16-10(13)14/h1-4H,5H2,(H5,13,14,15,16) |
| InChIKey | ZRQQZZPWCCEDMG-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.32 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|