C13H13ClF2N2O2 — CID 83082896
1-(2-chloro-4,6-difluorophenyl)-3-ethyl-1,4-diazepane-2,5-dione (PubChem CID 83082896) has the molecular formula C13H13ClF2N2O2 and a molecular weight of 302.71 g/mol. Its IUPAC name is 1-(2-chloro-4,6-difluorophenyl)-3-ethyl-1,4-diazepane-2,5-dione.
| Compound Name | 1-(2-chloro-4,6-difluorophenyl)-3-ethyl-1,4-diazepane-2,5-dione |
|---|---|
| PubChem CID | 83082896 |
| Molecular Formula | C13H13ClF2N2O2 |
| Molecular Weight | 302.71 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 1-(2-chloro-4,6-difluorophenyl)-3-ethyl-1,4-diazepane-2,5-dione |
| SMILES | CCC1NC(=O)CCN(c2c(F)cc(F)cc2Cl)C1=O |
| InChI | InChI=1S/C13H13ClF2N2O2/c1-2-10-13(20)18(4-3-11(19)17-10)12-8(14)5-7(15)6-9(12)16/h5-6,10H,2-4H2,1H3,(H,17,19) |
| InChIKey | ITHMMRMJEWTRBV-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.71 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |