About 2-(oxan-2-yloxy)ethyl N-(diaminomethylidene)carbamimidothioate
2-(oxan-2-yloxy)ethyl N-(diaminomethylidene)carbamimidothioate (PubChem CID 83083051) has the molecular formula C9H18N4O2S
and a molecular weight of 246.34 g/mol. Its IUPAC name is 2-(oxan-2-yloxy)ethyl N-(diaminomethylidene)carbamimidothioate.
Molecular Properties
| Compound Name | 2-(oxan-2-yloxy)ethyl N-(diaminomethylidene)carbamimidothioate |
| PubChem CID | 83083051 |
| Molecular Formula | C9H18N4O2S |
| Molecular Weight | 246.34 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 2-(oxan-2-yloxy)ethyl N-(diaminomethylidene)carbamimidothioate |
| SMILES | [H]/N=C(/N=C(N)N)SCCOC1CCCCO1 |
| InChI | InChI=1S/C9H18N4O2S/c10-8(11)13-9(12)16-6-5-15-7-3-1-2-4-14-7/h7H,1-6H2,(H5,10,11,12,13) |
| InChIKey | FJMHBCKGILPZLQ-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 106.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.34 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(oxan-2-yloxy)ethyl N-(diaminomethylidene)carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(oxan-2-yloxy)ethyl N-(diaminomethylidene)carbamimidothioate?
The IUPAC name of 2-(oxan-2-yloxy)ethyl N-(diaminomethylidene)carbamimidothioate (CID 83083051) is 2-(oxan-2-yloxy)ethyl N-(diaminomethylidene)carbamimidothioate.
What is the SMILES notation for 2-(oxan-2-yloxy)ethyl N-(diaminomethylidene)carbamimidothioate?
The canonical SMILES for 2-(oxan-2-yloxy)ethyl N-(diaminomethylidene)carbamimidothioate is [H]/N=C(/N=C(N)N)SCCOC1CCCCO1.
What is the InChIKey of 2-(oxan-2-yloxy)ethyl N-(diaminomethylidene)carbamimidothioate?
The InChIKey is FJMHBCKGILPZLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N4O2S/c10-8(11)13-9(12)16-6-5-15-7-3-1-2-4-14-7/h7H,1-6H2,(H5,10,11,12,13).
What are the key properties of 2-(oxan-2-yloxy)ethyl N-(diaminomethylidene)carbamimidothioate?
2-(oxan-2-yloxy)ethyl N-(diaminomethylidene)carbamimidothioate has a molecular weight of 246.34 g/mol, XLogP of 0.47, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(oxan-2-yloxy)ethyl N-(diaminomethylidene)carbamimidothioate is sourced from PubChem (CID 83083051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).