About (5-ethyl-1,3,4-oxadiazol-2-yl)methyl N-(diaminomethylidene)carbamimidothioate
(5-ethyl-1,3,4-oxadiazol-2-yl)methyl N-(diaminomethylidene)carbamimidothioate (PubChem CID 83083139) has the molecular formula C7H12N6OS
and a molecular weight of 228.28 g/mol. Its IUPAC name is (5-ethyl-1,3,4-oxadiazol-2-yl)methyl N-(diaminomethylidene)carbamimidothioate.
Molecular Properties
| Compound Name | (5-ethyl-1,3,4-oxadiazol-2-yl)methyl N-(diaminomethylidene)carbamimidothioate |
| PubChem CID | 83083139 |
| Molecular Formula | C7H12N6OS |
| Molecular Weight | 228.28 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | (5-ethyl-1,3,4-oxadiazol-2-yl)methyl N-(diaminomethylidene)carbamimidothioate |
| SMILES | [H]/N=C(/N=C(N)N)SCc1nnc(CC)o1 |
| InChI | InChI=1S/C7H12N6OS/c1-2-4-12-13-5(14-4)3-15-7(10)11-6(8)9/h2-3H2,1H3,(H5,8,9,10,11) |
| InChIKey | KXHIYMGIOPIXSQ-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.28 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (5-ethyl-1,3,4-oxadiazol-2-yl)methyl N-(diaminomethylidene)carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-ethyl-1,3,4-oxadiazol-2-yl)methyl N-(diaminomethylidene)carbamimidothioate?
The IUPAC name of (5-ethyl-1,3,4-oxadiazol-2-yl)methyl N-(diaminomethylidene)carbamimidothioate (CID 83083139) is (5-ethyl-1,3,4-oxadiazol-2-yl)methyl N-(diaminomethylidene)carbamimidothioate.
What is the SMILES notation for (5-ethyl-1,3,4-oxadiazol-2-yl)methyl N-(diaminomethylidene)carbamimidothioate?
The canonical SMILES for (5-ethyl-1,3,4-oxadiazol-2-yl)methyl N-(diaminomethylidene)carbamimidothioate is [H]/N=C(/N=C(N)N)SCc1nnc(CC)o1.
What is the InChIKey of (5-ethyl-1,3,4-oxadiazol-2-yl)methyl N-(diaminomethylidene)carbamimidothioate?
The InChIKey is KXHIYMGIOPIXSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N6OS/c1-2-4-12-13-5(14-4)3-15-7(10)11-6(8)9/h2-3H2,1H3,(H5,8,9,10,11).
What are the key properties of (5-ethyl-1,3,4-oxadiazol-2-yl)methyl N-(diaminomethylidene)carbamimidothioate?
(5-ethyl-1,3,4-oxadiazol-2-yl)methyl N-(diaminomethylidene)carbamimidothioate has a molecular weight of 228.28 g/mol, XLogP of 0.07, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-ethyl-1,3,4-oxadiazol-2-yl)methyl N-(diaminomethylidene)carbamimidothioate is sourced from PubChem (CID 83083139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).