About 2-(2,5-dioxoimidazolidin-1-yl)ethyl N-(diaminomethylidene)carbamimidothioate
2-(2,5-dioxoimidazolidin-1-yl)ethyl N-(diaminomethylidene)carbamimidothioate (PubChem CID 83083478) has the molecular formula C7H12N6O2S
and a molecular weight of 244.28 g/mol. Its IUPAC name is 2-(2,5-dioxoimidazolidin-1-yl)ethyl N-(diaminomethylidene)carbamimidothioate.
Molecular Properties
| Compound Name | 2-(2,5-dioxoimidazolidin-1-yl)ethyl N-(diaminomethylidene)carbamimidothioate |
| PubChem CID | 83083478 |
| Molecular Formula | C7H12N6O2S |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 2-(2,5-dioxoimidazolidin-1-yl)ethyl N-(diaminomethylidene)carbamimidothioate |
| SMILES | [H]/N=C(\N=C(N)N)SCCN1C(=O)CNC1=O |
| InChI | InChI=1S/C7H12N6O2S/c8-5(9)12-6(10)16-2-1-13-4(14)3-11-7(13)15/h1-3H2,(H,11,15)(H5,8,9,10,12) |
| InChIKey | ODNMHBNZSJNWQU-UHFFFAOYSA-N |
| XLogP | -1.52 |
| TPSA | 137.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,5-dioxoimidazolidin-1-yl)ethyl N-(diaminomethylidene)carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dioxoimidazolidin-1-yl)ethyl N-(diaminomethylidene)carbamimidothioate?
The IUPAC name of 2-(2,5-dioxoimidazolidin-1-yl)ethyl N-(diaminomethylidene)carbamimidothioate (CID 83083478) is 2-(2,5-dioxoimidazolidin-1-yl)ethyl N-(diaminomethylidene)carbamimidothioate.
What is the SMILES notation for 2-(2,5-dioxoimidazolidin-1-yl)ethyl N-(diaminomethylidene)carbamimidothioate?
The canonical SMILES for 2-(2,5-dioxoimidazolidin-1-yl)ethyl N-(diaminomethylidene)carbamimidothioate is [H]/N=C(\N=C(N)N)SCCN1C(=O)CNC1=O.
What is the InChIKey of 2-(2,5-dioxoimidazolidin-1-yl)ethyl N-(diaminomethylidene)carbamimidothioate?
The InChIKey is ODNMHBNZSJNWQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N6O2S/c8-5(9)12-6(10)16-2-1-13-4(14)3-11-7(13)15/h1-3H2,(H,11,15)(H5,8,9,10,12).
What are the key properties of 2-(2,5-dioxoimidazolidin-1-yl)ethyl N-(diaminomethylidene)carbamimidothioate?
2-(2,5-dioxoimidazolidin-1-yl)ethyl N-(diaminomethylidene)carbamimidothioate has a molecular weight of 244.28 g/mol, XLogP of -1.52, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dioxoimidazolidin-1-yl)ethyl N-(diaminomethylidene)carbamimidothioate is sourced from PubChem (CID 83083478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).