C10H13N7OS2 — CID 83083555
(2-ethyl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methyl N-(diaminomethylidene)carbamimidothioate (PubChem CID 83083555) has the molecular formula C10H13N7OS2 and a molecular weight of 311.40 g/mol. Its IUPAC name is (2-ethyl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methyl N-(diaminomethylidene)carbamimidothioate.
| Compound Name | (2-ethyl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methyl N-(diaminomethylidene)carbamimidothioate |
|---|---|
| PubChem CID | 83083555 |
| Molecular Formula | C10H13N7OS2 |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | (2-ethyl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methyl N-(diaminomethylidene)carbamimidothioate |
| SMILES | [H]/N=C(\N=C(N)N)SCc1cc(=O)n2nc(CC)sc2n1 |
| InChI | InChI=1S/C10H13N7OS2/c1-2-6-16-17-7(18)3-5(14-10(17)20-6)4-19-9(13)15-8(11)12/h3H,2,4H2,1H3,(H5,11,12,13,15) |
| InChIKey | XCWCQEYMMZLJAX-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 135.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|