About 1-bromo-N-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)methanesulfonamide
1-bromo-N-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)methanesulfonamide (PubChem CID 83083735) has the molecular formula C9H8BrN3O4S
and a molecular weight of 334.15 g/mol. Its IUPAC name is 1-bromo-N-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)methanesulfonamide.
Molecular Properties
| Compound Name | 1-bromo-N-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)methanesulfonamide |
| PubChem CID | 83083735 |
| Molecular Formula | C9H8BrN3O4S |
| Molecular Weight | 334.15 g/mol |
| Exact Mass | 332.94 |
| IUPAC Name | 1-bromo-N-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)methanesulfonamide |
| SMILES | O=c1[nH]c2ccc(NS(=O)(=O)CBr)cc2[nH]c1=O |
| InChI | InChI=1S/C9H8BrN3O4S/c10-4-18(16,17)13-5-1-2-6-7(3-5)12-9(15)8(14)11-6/h1-3,13H,4H2,(H,11,14)(H,12,15) |
| InChIKey | RQCLGDNIMCQLHA-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 111.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.15 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-N-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-N-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)methanesulfonamide?
The IUPAC name of 1-bromo-N-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)methanesulfonamide (CID 83083735) is 1-bromo-N-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)methanesulfonamide.
What is the SMILES notation for 1-bromo-N-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)methanesulfonamide?
The canonical SMILES for 1-bromo-N-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)methanesulfonamide is O=c1[nH]c2ccc(NS(=O)(=O)CBr)cc2[nH]c1=O.
What is the InChIKey of 1-bromo-N-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)methanesulfonamide?
The InChIKey is RQCLGDNIMCQLHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BrN3O4S/c10-4-18(16,17)13-5-1-2-6-7(3-5)12-9(15)8(14)11-6/h1-3,13H,4H2,(H,11,14)(H,12,15).
What are the key properties of 1-bromo-N-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)methanesulfonamide?
1-bromo-N-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)methanesulfonamide has a molecular weight of 334.15 g/mol, XLogP of 0.31, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-N-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)methanesulfonamide is sourced from PubChem (CID 83083735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).