About 1-bromo-N-propyl-N-(2,2,2-trifluoroethyl)methanesulfonamide
1-bromo-N-propyl-N-(2,2,2-trifluoroethyl)methanesulfonamide (PubChem CID 83084161) has the molecular formula C6H11BrF3NO2S
and a molecular weight of 298.12 g/mol. Its IUPAC name is 1-bromo-N-propyl-N-(2,2,2-trifluoroethyl)methanesulfonamide.
Molecular Properties
| Compound Name | 1-bromo-N-propyl-N-(2,2,2-trifluoroethyl)methanesulfonamide |
| PubChem CID | 83084161 |
| Molecular Formula | C6H11BrF3NO2S |
| Molecular Weight | 298.12 g/mol |
| Exact Mass | 296.96 |
| IUPAC Name | 1-bromo-N-propyl-N-(2,2,2-trifluoroethyl)methanesulfonamide |
| SMILES | CCCN(CC(F)(F)F)S(=O)(=O)CBr |
| InChI | InChI=1S/C6H11BrF3NO2S/c1-2-3-11(4-6(8,9)10)14(12,13)5-7/h2-5H2,1H3 |
| InChIKey | UIDDZBFBAROPAQ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.12 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-N-propyl-N-(2,2,2-trifluoroethyl)methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-N-propyl-N-(2,2,2-trifluoroethyl)methanesulfonamide?
The IUPAC name of 1-bromo-N-propyl-N-(2,2,2-trifluoroethyl)methanesulfonamide (CID 83084161) is 1-bromo-N-propyl-N-(2,2,2-trifluoroethyl)methanesulfonamide.
What is the SMILES notation for 1-bromo-N-propyl-N-(2,2,2-trifluoroethyl)methanesulfonamide?
The canonical SMILES for 1-bromo-N-propyl-N-(2,2,2-trifluoroethyl)methanesulfonamide is CCCN(CC(F)(F)F)S(=O)(=O)CBr.
What is the InChIKey of 1-bromo-N-propyl-N-(2,2,2-trifluoroethyl)methanesulfonamide?
The InChIKey is UIDDZBFBAROPAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11BrF3NO2S/c1-2-3-11(4-6(8,9)10)14(12,13)5-7/h2-5H2,1H3.
What are the key properties of 1-bromo-N-propyl-N-(2,2,2-trifluoroethyl)methanesulfonamide?
1-bromo-N-propyl-N-(2,2,2-trifluoroethyl)methanesulfonamide has a molecular weight of 298.12 g/mol, XLogP of 1.94, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-N-propyl-N-(2,2,2-trifluoroethyl)methanesulfonamide is sourced from PubChem (CID 83084161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).