About 1-bromo-N-(2,4,4-trimethylpentan-2-yl)methanesulfonamide
1-bromo-N-(2,4,4-trimethylpentan-2-yl)methanesulfonamide (PubChem CID 83084423) has the molecular formula C9H20BrNO2S
and a molecular weight of 286.24 g/mol. Its IUPAC name is 1-bromo-N-(2,4,4-trimethylpentan-2-yl)methanesulfonamide.
Molecular Properties
| Compound Name | 1-bromo-N-(2,4,4-trimethylpentan-2-yl)methanesulfonamide |
| PubChem CID | 83084423 |
| Molecular Formula | C9H20BrNO2S |
| Molecular Weight | 286.24 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | 1-bromo-N-(2,4,4-trimethylpentan-2-yl)methanesulfonamide |
| SMILES | CC(C)(C)CC(C)(C)NS(=O)(=O)CBr |
| InChI | InChI=1S/C9H20BrNO2S/c1-8(2,3)6-9(4,5)11-14(12,13)7-10/h11H,6-7H2,1-5H3 |
| InChIKey | JAHVHKYGJLDTNR-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.24 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-N-(2,4,4-trimethylpentan-2-yl)methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-N-(2,4,4-trimethylpentan-2-yl)methanesulfonamide?
The IUPAC name of 1-bromo-N-(2,4,4-trimethylpentan-2-yl)methanesulfonamide (CID 83084423) is 1-bromo-N-(2,4,4-trimethylpentan-2-yl)methanesulfonamide.
What is the SMILES notation for 1-bromo-N-(2,4,4-trimethylpentan-2-yl)methanesulfonamide?
The canonical SMILES for 1-bromo-N-(2,4,4-trimethylpentan-2-yl)methanesulfonamide is CC(C)(C)CC(C)(C)NS(=O)(=O)CBr.
What is the InChIKey of 1-bromo-N-(2,4,4-trimethylpentan-2-yl)methanesulfonamide?
The InChIKey is JAHVHKYGJLDTNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20BrNO2S/c1-8(2,3)6-9(4,5)11-14(12,13)7-10/h11H,6-7H2,1-5H3.
What are the key properties of 1-bromo-N-(2,4,4-trimethylpentan-2-yl)methanesulfonamide?
1-bromo-N-(2,4,4-trimethylpentan-2-yl)methanesulfonamide has a molecular weight of 286.24 g/mol, XLogP of 2.47, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-N-(2,4,4-trimethylpentan-2-yl)methanesulfonamide is sourced from PubChem (CID 83084423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).