C11H12N2OS — CID 83085504
6-cyclopropyl-2,3-dimethylimidazo[2,1-b][1,3]thiazole-5-carbaldehyde (PubChem CID 83085504) has the molecular formula C11H12N2OS and a molecular weight of 220.30 g/mol. Its IUPAC name is 6-cyclopropyl-2,3-dimethylimidazo[2,1-b][1,3]thiazole-5-carbaldehyde.
| Compound Name | 6-cyclopropyl-2,3-dimethylimidazo[2,1-b][1,3]thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 83085504 |
| Molecular Formula | C11H12N2OS |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 6-cyclopropyl-2,3-dimethylimidazo[2,1-b][1,3]thiazole-5-carbaldehyde |
| SMILES | Cc1sc2nc(C3CC3)c(C=O)n2c1C |
| InChI | InChI=1S/C11H12N2OS/c1-6-7(2)15-11-12-10(8-3-4-8)9(5-14)13(6)11/h5,8H,3-4H2,1-2H3 |
| InChIKey | RTQQRQSLVABQNZ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|