C7H10BrN3O4S — CID 83085989
7-(bromomethylsulfonyl)-1,3,7-triazaspiro[4.4]nonane-2,4-dione (PubChem CID 83085989) has the molecular formula C7H10BrN3O4S and a molecular weight of 312.15 g/mol. Its IUPAC name is 7-(bromomethylsulfonyl)-1,3,7-triazaspiro[4.4]nonane-2,4-dione.
| Compound Name | 7-(bromomethylsulfonyl)-1,3,7-triazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 83085989 |
| Molecular Formula | C7H10BrN3O4S |
| Molecular Weight | 312.15 g/mol |
| Exact Mass | 310.96 |
| IUPAC Name | 7-(bromomethylsulfonyl)-1,3,7-triazaspiro[4.4]nonane-2,4-dione |
| SMILES | O=C1NC(=O)C2(CCN(S(=O)(=O)CBr)C2)N1 |
| InChI | InChI=1S/C7H10BrN3O4S/c8-4-16(14,15)11-2-1-7(3-11)5(12)9-6(13)10-7/h1-4H2,(H2,9,10,12,13) |
| InChIKey | QKOZTIYBHSSAGM-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.15 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|