About 1-bromo-N-(2,3-dimethylcyclopentyl)methanesulfonamide
1-bromo-N-(2,3-dimethylcyclopentyl)methanesulfonamide (PubChem CID 83086490) has the molecular formula C8H16BrNO2S
and a molecular weight of 270.19 g/mol. Its IUPAC name is 1-bromo-N-(2,3-dimethylcyclopentyl)methanesulfonamide.
Molecular Properties
| Compound Name | 1-bromo-N-(2,3-dimethylcyclopentyl)methanesulfonamide |
| PubChem CID | 83086490 |
| Molecular Formula | C8H16BrNO2S |
| Molecular Weight | 270.19 g/mol |
| Exact Mass | 269.01 |
| IUPAC Name | 1-bromo-N-(2,3-dimethylcyclopentyl)methanesulfonamide |
| SMILES | CC1CCC(NS(=O)(=O)CBr)C1C |
| InChI | InChI=1S/C8H16BrNO2S/c1-6-3-4-8(7(6)2)10-13(11,12)5-9/h6-8,10H,3-5H2,1-2H3 |
| InChIKey | LCFFRAMCIHFNPK-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.19 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-N-(2,3-dimethylcyclopentyl)methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-N-(2,3-dimethylcyclopentyl)methanesulfonamide?
The IUPAC name of 1-bromo-N-(2,3-dimethylcyclopentyl)methanesulfonamide (CID 83086490) is 1-bromo-N-(2,3-dimethylcyclopentyl)methanesulfonamide.
What is the SMILES notation for 1-bromo-N-(2,3-dimethylcyclopentyl)methanesulfonamide?
The canonical SMILES for 1-bromo-N-(2,3-dimethylcyclopentyl)methanesulfonamide is CC1CCC(NS(=O)(=O)CBr)C1C.
What is the InChIKey of 1-bromo-N-(2,3-dimethylcyclopentyl)methanesulfonamide?
The InChIKey is LCFFRAMCIHFNPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16BrNO2S/c1-6-3-4-8(7(6)2)10-13(11,12)5-9/h6-8,10H,3-5H2,1-2H3.
What are the key properties of 1-bromo-N-(2,3-dimethylcyclopentyl)methanesulfonamide?
1-bromo-N-(2,3-dimethylcyclopentyl)methanesulfonamide has a molecular weight of 270.19 g/mol, XLogP of 1.69, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-N-(2,3-dimethylcyclopentyl)methanesulfonamide is sourced from PubChem (CID 83086490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).