About 1-bromo-N-[3,5-dichloro-4-(difluoromethoxy)phenyl]methanesulfonamide
1-bromo-N-[3,5-dichloro-4-(difluoromethoxy)phenyl]methanesulfonamide (PubChem CID 83086658) has the molecular formula C8H6BrCl2F2NO3S
and a molecular weight of 385.01 g/mol. Its IUPAC name is 1-bromo-N-[3,5-dichloro-4-(difluoromethoxy)phenyl]methanesulfonamide.
Molecular Properties
| Compound Name | 1-bromo-N-[3,5-dichloro-4-(difluoromethoxy)phenyl]methanesulfonamide |
| PubChem CID | 83086658 |
| Molecular Formula | C8H6BrCl2F2NO3S |
| Molecular Weight | 385.01 g/mol |
| Exact Mass | 382.86 |
| IUPAC Name | 1-bromo-N-[3,5-dichloro-4-(difluoromethoxy)phenyl]methanesulfonamide |
| SMILES | O=S(=O)(CBr)Nc1cc(Cl)c(OC(F)F)c(Cl)c1 |
| InChI | InChI=1S/C8H6BrCl2F2NO3S/c9-3-18(15,16)14-4-1-5(10)7(6(11)2-4)17-8(12)13/h1-2,8,14H,3H2 |
| InChIKey | YYSFMFTYAXFCTH-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.01 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-N-[3,5-dichloro-4-(difluoromethoxy)phenyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-N-[3,5-dichloro-4-(difluoromethoxy)phenyl]methanesulfonamide?
The IUPAC name of 1-bromo-N-[3,5-dichloro-4-(difluoromethoxy)phenyl]methanesulfonamide (CID 83086658) is 1-bromo-N-[3,5-dichloro-4-(difluoromethoxy)phenyl]methanesulfonamide.
What is the SMILES notation for 1-bromo-N-[3,5-dichloro-4-(difluoromethoxy)phenyl]methanesulfonamide?
The canonical SMILES for 1-bromo-N-[3,5-dichloro-4-(difluoromethoxy)phenyl]methanesulfonamide is O=S(=O)(CBr)Nc1cc(Cl)c(OC(F)F)c(Cl)c1.
What is the InChIKey of 1-bromo-N-[3,5-dichloro-4-(difluoromethoxy)phenyl]methanesulfonamide?
The InChIKey is YYSFMFTYAXFCTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6BrCl2F2NO3S/c9-3-18(15,16)14-4-1-5(10)7(6(11)2-4)17-8(12)13/h1-2,8,14H,3H2.
What are the key properties of 1-bromo-N-[3,5-dichloro-4-(difluoromethoxy)phenyl]methanesulfonamide?
1-bromo-N-[3,5-dichloro-4-(difluoromethoxy)phenyl]methanesulfonamide has a molecular weight of 385.01 g/mol, XLogP of 3.69, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-N-[3,5-dichloro-4-(difluoromethoxy)phenyl]methanesulfonamide is sourced from PubChem (CID 83086658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).