C12H13F3N2S — CID 83086723
1,2-dimethyl-7-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,3]thiazolo[3,2-a]benzimidazole (PubChem CID 83086723) has the molecular formula C12H13F3N2S and a molecular weight of 274.31 g/mol. Its IUPAC name is 1,2-dimethyl-7-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,3]thiazolo[3,2-a]benzimidazole.
| Compound Name | 1,2-dimethyl-7-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,3]thiazolo[3,2-a]benzimidazole |
|---|---|
| PubChem CID | 83086723 |
| Molecular Formula | C12H13F3N2S |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 1,2-dimethyl-7-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,3]thiazolo[3,2-a]benzimidazole |
| SMILES | Cc1sc2nc3c(n2c1C)CC(C(F)(F)F)CC3 |
| InChI | InChI=1S/C12H13F3N2S/c1-6-7(2)18-11-16-9-4-3-8(12(13,14)15)5-10(9)17(6)11/h8H,3-5H2,1-2H3 |
| InChIKey | AWUWRURXRHJFDQ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |