About 2-chloro-N-[(E)-4-chlorobut-2-enyl]-4,6-difluoroaniline
2-chloro-N-[(E)-4-chlorobut-2-enyl]-4,6-difluoroaniline (PubChem CID 83087178) has the molecular formula C10H9Cl2F2N
and a molecular weight of 252.09 g/mol. Its IUPAC name is 2-chloro-N-[(E)-4-chlorobut-2-enyl]-4,6-difluoroaniline.
Molecular Properties
| Compound Name | 2-chloro-N-[(E)-4-chlorobut-2-enyl]-4,6-difluoroaniline |
| PubChem CID | 83087178 |
| Molecular Formula | C10H9Cl2F2N |
| Molecular Weight | 252.09 g/mol |
| Exact Mass | 251.01 |
| IUPAC Name | 2-chloro-N-[(E)-4-chlorobut-2-enyl]-4,6-difluoroaniline |
| SMILES | Fc1cc(F)c(NC/C=C/CCl)c(Cl)c1 |
| InChI | InChI=1S/C10H9Cl2F2N/c11-3-1-2-4-15-10-8(12)5-7(13)6-9(10)14/h1-2,5-6,15H,3-4H2/b2-1+ |
| InChIKey | NZBDEFIPDFTASZ-OWOJBTEDSA-N |
| XLogP | 3.83 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.09 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N-[(E)-4-chlorobut-2-enyl]-4,6-difluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-[(E)-4-chlorobut-2-enyl]-4,6-difluoroaniline?
The IUPAC name of 2-chloro-N-[(E)-4-chlorobut-2-enyl]-4,6-difluoroaniline (CID 83087178) is 2-chloro-N-[(E)-4-chlorobut-2-enyl]-4,6-difluoroaniline.
What is the SMILES notation for 2-chloro-N-[(E)-4-chlorobut-2-enyl]-4,6-difluoroaniline?
The canonical SMILES for 2-chloro-N-[(E)-4-chlorobut-2-enyl]-4,6-difluoroaniline is Fc1cc(F)c(NC/C=C/CCl)c(Cl)c1.
What is the InChIKey of 2-chloro-N-[(E)-4-chlorobut-2-enyl]-4,6-difluoroaniline?
The InChIKey is NZBDEFIPDFTASZ-OWOJBTEDSA-N. The full InChI is InChI=1S/C10H9Cl2F2N/c11-3-1-2-4-15-10-8(12)5-7(13)6-9(10)14/h1-2,5-6,15H,3-4H2/b2-1+.
What are the key properties of 2-chloro-N-[(E)-4-chlorobut-2-enyl]-4,6-difluoroaniline?
2-chloro-N-[(E)-4-chlorobut-2-enyl]-4,6-difluoroaniline has a molecular weight of 252.09 g/mol, XLogP of 3.83, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-[(E)-4-chlorobut-2-enyl]-4,6-difluoroaniline is sourced from PubChem (CID 83087178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).