C9H3ClF2N2O3 — CID 83087257
1-(2-chloro-4,6-difluorophenyl)imidazolidine-2,4,5-trione (PubChem CID 83087257) has the molecular formula C9H3ClF2N2O3 and a molecular weight of 260.58 g/mol. Its IUPAC name is 1-(2-chloro-4,6-difluorophenyl)imidazolidine-2,4,5-trione.
| Compound Name | 1-(2-chloro-4,6-difluorophenyl)imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 83087257 |
| Molecular Formula | C9H3ClF2N2O3 |
| Molecular Weight | 260.58 g/mol |
| Exact Mass | 259.98 |
| IUPAC Name | 1-(2-chloro-4,6-difluorophenyl)imidazolidine-2,4,5-trione |
| SMILES | O=C1NC(=O)N(c2c(F)cc(F)cc2Cl)C1=O |
| InChI | InChI=1S/C9H3ClF2N2O3/c10-4-1-3(11)2-5(12)6(4)14-8(16)7(15)13-9(14)17/h1-2H,(H,13,15,17) |
| InChIKey | ABQFEJBFYBOBFZ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.58 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|