C12H8ClF2NO3S — CID 83088230
N-(2-chloro-4,6-difluorophenyl)-4-hydroxybenzenesulfonamide (PubChem CID 83088230) has the molecular formula C12H8ClF2NO3S and a molecular weight of 319.72 g/mol. Its IUPAC name is N-(2-chloro-4,6-difluorophenyl)-4-hydroxybenzenesulfonamide.
| Compound Name | N-(2-chloro-4,6-difluorophenyl)-4-hydroxybenzenesulfonamide |
|---|---|
| PubChem CID | 83088230 |
| Molecular Formula | C12H8ClF2NO3S |
| Molecular Weight | 319.72 g/mol |
| Exact Mass | 318.99 |
| IUPAC Name | N-(2-chloro-4,6-difluorophenyl)-4-hydroxybenzenesulfonamide |
| SMILES | O=S(=O)(Nc1c(F)cc(F)cc1Cl)c1ccc(O)cc1 |
| InChI | InChI=1S/C12H8ClF2NO3S/c13-10-5-7(14)6-11(15)12(10)16-20(18,19)9-3-1-8(17)2-4-9/h1-6,16-17H |
| InChIKey | LWFBUNHLSISFGN-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.72 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |