C15H26N4 — CID 83089268
2-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-2-(1,3-dimethylpyrazol-4-yl)ethanamine (PubChem CID 83089268) has the molecular formula C15H26N4 and a molecular weight of 262.40 g/mol. Its IUPAC name is 2-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-2-(1,3-dimethylpyrazol-4-yl)ethanamine.
| Compound Name | 2-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-2-(1,3-dimethylpyrazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 83089268 |
| Molecular Formula | C15H26N4 |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.22 |
| IUPAC Name | 2-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-2-(1,3-dimethylpyrazol-4-yl)ethanamine |
| SMILES | Cc1nn(C)cc1C(CN)N1CCCC2CCCC21 |
| InChI | InChI=1S/C15H26N4/c1-11-13(10-18(2)17-11)15(9-16)19-8-4-6-12-5-3-7-14(12)19/h10,12,14-15H,3-9,16H2,1-2H3 |
| InChIKey | GGEMIEZKOSNNHV-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |